C27H26ClN3O6 — CID 68821609
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-dimethylbenzoyl)hydrazinyl]propanoic acid (PubChem CID 68821609) has the molecular formula C27H26ClN3O6 and a molecular weight of 523.97 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-dimethylbenzoyl)hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-dimethylbenzoyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 68821609 |
| Molecular Formula | C27H26ClN3O6 |
| Molecular Weight | 523.97 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-dimethylbenzoyl)hydrazinyl]propanoic acid |
| SMILES | Cc1cc(C)cc(C(=O)N(N[C@@H](C)C(=O)O)C(=O)c2ccc(C(=O)NCc3cccc(O)c3)cc2Cl)c1 |
| InChI | InChI=1S/C27H26ClN3O6/c1-15-9-16(2)11-20(10-15)25(34)31(30-17(3)27(36)37)26(35)22-8-7-19(13-23(22)28)24(33)29-14-18-5-4-6-21(32)12-18/h4-13,17,30,32H,14H2,1-3H3,(H,29,33)(H,36,37)/t17-/m0/s1 |
| InChIKey | DWAVIOOLJSEXJW-KRWDZBQOSA-N |
| XLogP | 3.85 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.97 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|