C28H27Br2ClN4O6 — CID 68819463
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-[5-(3,4-dibromobutyl)pyridine-2-carbonyl]hydrazinyl]propanoic acid (PubChem CID 68819463) has the molecular formula C28H27Br2ClN4O6 and a molecular weight of 710.81 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-[5-(3,4-dibromobutyl)pyridine-2-carbonyl]hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-[5-(3,4-dibromobutyl)pyridine-2-carbonyl]hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 68819463 |
| Molecular Formula | C28H27Br2ClN4O6 |
| Molecular Weight | 710.81 g/mol |
| Exact Mass | 708.00 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-[5-(3,4-dibromobutyl)pyridine-2-carbonyl]hydrazinyl]propanoic acid |
| SMILES | C[C@H](NN(C(=O)c1ccc(CCC(Br)CBr)cn1)C(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C28H27Br2ClN4O6/c1-16(28(40)41)34-35(27(39)24-10-6-17(14-32-24)5-8-20(30)13-29)26(38)22-9-7-19(12-23(22)31)25(37)33-15-18-3-2-4-21(36)11-18/h2-4,6-7,9-12,14,16,20,34,36H,5,8,13,15H2,1H3,(H,33,37)(H,40,41)/t16-,20?/m0/s1 |
| InChIKey | SSMLECCQXZZVJA-DJZRFWRSSA-N |
| XLogP | 4.72 |
| TPSA | 148.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.81 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|