C27H26ClN3O7 — CID 68821991
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-ethoxybenzoyl)hydrazinyl]propanoic acid (PubChem CID 68821991) has the molecular formula C27H26ClN3O7 and a molecular weight of 539.97 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-ethoxybenzoyl)hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-ethoxybenzoyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 68821991 |
| Molecular Formula | C27H26ClN3O7 |
| Molecular Weight | 539.97 g/mol |
| Exact Mass | 539.15 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(4-ethoxybenzoyl)hydrazinyl]propanoic acid |
| SMILES | CCOc1ccc(C(=O)N(N[C@@H](C)C(=O)O)C(=O)c2ccc(C(=O)NCc3cccc(O)c3)cc2Cl)cc1 |
| InChI | InChI=1S/C27H26ClN3O7/c1-3-38-21-10-7-18(8-11-21)25(34)31(30-16(2)27(36)37)26(35)22-12-9-19(14-23(22)28)24(33)29-15-17-5-4-6-20(32)13-17/h4-14,16,30,32H,3,15H2,1-2H3,(H,29,33)(H,36,37)/t16-/m0/s1 |
| InChIKey | SKBWCCIEADZJHC-INIZCTEOSA-N |
| XLogP | 3.63 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.97 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|