C25H23ClN4O5S — CID 87587508
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(2-pyridin-4-ylethanethioyl)hydrazinyl]propanoic acid (PubChem CID 87587508) has the molecular formula C25H23ClN4O5S and a molecular weight of 527.00 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(2-pyridin-4-ylethanethioyl)hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(2-pyridin-4-ylethanethioyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 87587508 |
| Molecular Formula | C25H23ClN4O5S |
| Molecular Weight | 527.00 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(2-pyridin-4-ylethanethioyl)hydrazinyl]propanoic acid |
| SMILES | C[C@H](NN(C(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl)C(=S)Cc1ccncc1)C(=O)O |
| InChI | InChI=1S/C25H23ClN4O5S/c1-15(25(34)35)29-30(22(36)12-16-7-9-27-10-8-16)24(33)20-6-5-18(13-21(20)26)23(32)28-14-17-3-2-4-19(31)11-17/h2-11,13,15,29,31H,12,14H2,1H3,(H,28,32)(H,34,35)/t15-/m0/s1 |
| InChIKey | ZIPRWMGHYZYCBJ-HNNXBMFYSA-N |
| XLogP | 3.36 |
| TPSA | 131.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.00 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|