C24H21Cl2N3O7S — CID 68819589
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(5-chloro-4-methoxythiophene-3-carbonyl)hydrazinyl]propanoic acid (PubChem CID 68819589) has the molecular formula C24H21Cl2N3O7S and a molecular weight of 566.42 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(5-chloro-4-methoxythiophene-3-carbonyl)hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(5-chloro-4-methoxythiophene-3-carbonyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 68819589 |
| Molecular Formula | C24H21Cl2N3O7S |
| Molecular Weight | 566.42 g/mol |
| Exact Mass | 565.05 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(5-chloro-4-methoxythiophene-3-carbonyl)hydrazinyl]propanoic acid |
| SMILES | COc1c(C(=O)N(N[C@@H](C)C(=O)O)C(=O)c2ccc(C(=O)NCc3cccc(O)c3)cc2Cl)csc1Cl |
| InChI | InChI=1S/C24H21Cl2N3O7S/c1-12(24(34)35)28-29(23(33)17-11-37-20(26)19(17)36-2)22(32)16-7-6-14(9-18(16)25)21(31)27-10-13-4-3-5-15(30)8-13/h3-9,11-12,28,30H,10H2,1-2H3,(H,27,31)(H,34,35)/t12-/m0/s1 |
| InChIKey | OHDBCLLKMPKOHR-LBPRGKRZSA-N |
| XLogP | 3.96 |
| TPSA | 145.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|