C25H20ClF2N3O6 — CID 68821960
(2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-difluorobenzoyl)hydrazinyl]propanoic acid (PubChem CID 68821960) has the molecular formula C25H20ClF2N3O6 and a molecular weight of 531.90 g/mol. Its IUPAC name is (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-difluorobenzoyl)hydrazinyl]propanoic acid.
| Compound Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-difluorobenzoyl)hydrazinyl]propanoic acid |
|---|---|
| PubChem CID | 68821960 |
| Molecular Formula | C25H20ClF2N3O6 |
| Molecular Weight | 531.90 g/mol |
| Exact Mass | 531.10 |
| IUPAC Name | (2S)-2-[2-[2-chloro-4-[(3-hydroxyphenyl)methylcarbamoyl]benzoyl]-2-(3,5-difluorobenzoyl)hydrazinyl]propanoic acid |
| SMILES | C[C@H](NN(C(=O)c1cc(F)cc(F)c1)C(=O)c1ccc(C(=O)NCc2cccc(O)c2)cc1Cl)C(=O)O |
| InChI | InChI=1S/C25H20ClF2N3O6/c1-13(25(36)37)30-31(23(34)16-8-17(27)11-18(28)9-16)24(35)20-6-5-15(10-21(20)26)22(33)29-12-14-3-2-4-19(32)7-14/h2-11,13,30,32H,12H2,1H3,(H,29,33)(H,36,37)/t13-/m0/s1 |
| InChIKey | RIFYVOZDPQLIPC-ZDUSSCGKSA-N |
| XLogP | 3.51 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|