C25H24BrClN2O4 — CID 129138808
(2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-10-chloro-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol (PubChem CID 129138808) has the molecular formula C25H24BrClN2O4 and a molecular weight of 531.83 g/mol. Its IUPAC name is (2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-10-chloro-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol.
| Compound Name | (2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-10-chloro-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol |
|---|---|
| PubChem CID | 129138808 |
| Molecular Formula | C25H24BrClN2O4 |
| Molecular Weight | 531.83 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | (2R,3R,4R,5S,6R)-3-(aminomethyl)-6-(4-bromophenyl)-10-chloro-4-(hydroxymethyl)-12-methoxy-5-phenyl-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-2-ol |
| SMILES | COc1nc(Cl)cc2c1[C@]1(O)[C@@H](CN)[C@H](CO)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C25H24BrClN2O4/c1-32-23-22-19(11-20(27)29-23)33-25(15-7-9-16(26)10-8-15)21(14-5-3-2-4-6-14)17(13-30)18(12-28)24(22,25)31/h2-11,17-18,21,30-31H,12-13,28H2,1H3/t17-,18-,21+,24+,25-/m0/s1 |
| InChIKey | WPOLDUJCXJEWCG-UVDXPZGVSA-N |
| XLogP | 3.96 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|