C29H28BrN3O4 — CID 140787858
(2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-isocyano-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol (PubChem CID 140787858) has the molecular formula C29H28BrN3O4 and a molecular weight of 562.46 g/mol. Its IUPAC name is (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-isocyano-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol.
| Compound Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-isocyano-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
|---|---|
| PubChem CID | 140787858 |
| Molecular Formula | C29H28BrN3O4 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | (2S,3R,4S,5S,6R)-6-(4-bromophenyl)-10-isocyano-12-methoxy-5-phenyl-4-(pyrrolidin-1-ylmethyl)-7-oxa-11-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-triene-2,3-diol |
| SMILES | [C-]#[N+]c1cc2c(c(OC)n1)[C@]1(O)[C@H](O)[C@H](CN3CCCC3)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C29H28BrN3O4/c1-31-23-16-22-25(27(32-23)36-2)28(35)26(34)21(17-33-14-6-7-15-33)24(18-8-4-3-5-9-18)29(28,37-22)19-10-12-20(30)13-11-19/h3-5,8-13,16,21,24,26,34-35H,6-7,14-15,17H2,2H3/t21-,24-,26-,28+,29+/m1/s1 |
| InChIKey | JODUUTUWRRMXMC-SKIUGIQWSA-N |
| XLogP | 4.75 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|