C29H31BrN2O4 — CID 163482115
(2R,3R,4S,5S,6R)-6-(4-bromophenyl)-12-methoxy-2-methyl-4-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-3-ol (PubChem CID 163482115) has the molecular formula C29H31BrN2O4 and a molecular weight of 551.48 g/mol. Its IUPAC name is (2R,3R,4S,5S,6R)-6-(4-bromophenyl)-12-methoxy-2-methyl-4-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-3-ol.
| Compound Name | (2R,3R,4S,5S,6R)-6-(4-bromophenyl)-12-methoxy-2-methyl-4-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-3-ol |
|---|---|
| PubChem CID | 163482115 |
| Molecular Formula | C29H31BrN2O4 |
| Molecular Weight | 551.48 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | (2R,3R,4S,5S,6R)-6-(4-bromophenyl)-12-methoxy-2-methyl-4-(morpholin-4-ylmethyl)-5-phenyl-7-oxa-10-azatricyclo[6.4.0.02,6]dodeca-1(12),8,10-trien-3-ol |
| SMILES | COc1cncc2c1[C@]1(C)[C@H](O)[C@H](CN3CCOCC3)[C@@H](c3ccccc3)[C@]1(c1ccc(Br)cc1)O2 |
| InChI | InChI=1S/C29H31BrN2O4/c1-28-26-23(34-2)16-31-17-24(26)36-29(28,20-8-10-21(30)11-9-20)25(19-6-4-3-5-7-19)22(27(28)33)18-32-12-14-35-15-13-32/h3-11,16-17,22,25,27,33H,12-15,18H2,1-2H3/t22-,25-,27-,28-,29+/m1/s1 |
| InChIKey | CFLMKXZAMUQLFC-NLPUROKSSA-N |
| XLogP | 4.51 |
| TPSA | 64.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |