C20H19NO5S — CID 129142558
3-hydroxy-2-(methylsulfonylmethyl)-6-[(4-phenylanilino)methyl]pyran-4-one (PubChem CID 129142558) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 3-hydroxy-2-(methylsulfonylmethyl)-6-[(4-phenylanilino)methyl]pyran-4-one.
| Compound Name | 3-hydroxy-2-(methylsulfonylmethyl)-6-[(4-phenylanilino)methyl]pyran-4-one |
|---|---|
| PubChem CID | 129142558 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3-hydroxy-2-(methylsulfonylmethyl)-6-[(4-phenylanilino)methyl]pyran-4-one |
| SMILES | CS(=O)(=O)Cc1oc(CNc2ccc(-c3ccccc3)cc2)cc(=O)c1O |
| InChI | InChI=1S/C20H19NO5S/c1-27(24,25)13-19-20(23)18(22)11-17(26-19)12-21-16-9-7-15(8-10-16)14-5-3-2-4-6-14/h2-11,21,23H,12-13H2,1H3 |
| InChIKey | FYLZXHSYNBXUOH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |