C8H10INOS — CID 129144288
(4-hydroxy-2,5-dimethylanilino) thiohypoiodite (PubChem CID 129144288) has the molecular formula C8H10INOS and a molecular weight of 295.15 g/mol. Its IUPAC name is (4-hydroxy-2,5-dimethylanilino) thiohypoiodite.
| Compound Name | (4-hydroxy-2,5-dimethylanilino) thiohypoiodite |
|---|---|
| PubChem CID | 129144288 |
| Molecular Formula | C8H10INOS |
| Molecular Weight | 295.15 g/mol |
| Exact Mass | 294.95 |
| IUPAC Name | (4-hydroxy-2,5-dimethylanilino) thiohypoiodite |
| SMILES | Cc1cc(NSI)c(C)cc1O |
| InChI | InChI=1S/C8H10INOS/c1-5-4-8(11)6(2)3-7(5)10-12-9/h3-4,10-11H,1-2H3 |
| InChIKey | WYGGOGCDDPIVER-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.15 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|