C16H20INO4S — CID 145310097
3,5-dimethoxyphenol;(4-hydroxy-2,5-dimethylanilino) thiohypoiodite (PubChem CID 145310097) has the molecular formula C16H20INO4S and a molecular weight of 449.31 g/mol. Its IUPAC name is 3,5-dimethoxyphenol;(4-hydroxy-2,5-dimethylanilino) thiohypoiodite.
| Compound Name | 3,5-dimethoxyphenol;(4-hydroxy-2,5-dimethylanilino) thiohypoiodite |
|---|---|
| PubChem CID | 145310097 |
| Molecular Formula | C16H20INO4S |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | 3,5-dimethoxyphenol;(4-hydroxy-2,5-dimethylanilino) thiohypoiodite |
| SMILES | COc1cc(O)cc(OC)c1.Cc1cc(NSI)c(C)cc1O |
| InChI | InChI=1S/C8H10INOS.C8H10O3/c1-5-4-8(11)6(2)3-7(5)10-12-9;1-10-7-3-6(9)4-8(5-7)11-2/h3-4,10-11H,1-2H3;3-5,9H,1-2H3 |
| InChIKey | DCJSAOHPNMXPEM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|