C18H18INO3S — CID 145310102
(4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol (PubChem CID 145310102) has the molecular formula C18H18INO3S and a molecular weight of 455.32 g/mol. Its IUPAC name is (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol.
| Compound Name | (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol |
|---|---|
| PubChem CID | 145310102 |
| Molecular Formula | C18H18INO3S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol |
| SMILES | Cc1cc(NSI)c(C)cc1O.Oc1cc2ccccc2cc1O |
| InChI | InChI=1S/C10H8O2.C8H10INOS/c11-9-5-7-3-1-2-4-8(7)6-10(9)12;1-5-4-8(11)6(2)3-7(5)10-12-9/h1-6,11-12H;3-4,10-11H,1-2H3 |
| InChIKey | PQWNAZJQGRLXFX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|