About (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol
(4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol (PubChem CID 145310102) has the molecular formula C18H18INO3S
and a molecular weight of 455.32 g/mol. Its IUPAC name is (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol.
Molecular Properties
| Compound Name | (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol |
| PubChem CID | 145310102 |
| Molecular Formula | C18H18INO3S |
| Molecular Weight | 455.32 g/mol |
| Exact Mass | 455.01 |
| IUPAC Name | (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol |
| SMILES | Cc1cc(NSI)c(C)cc1O.Oc1cc2ccccc2cc1O |
| InChI | InChI=1S/C10H8O2.C8H10INOS/c11-9-5-7-3-1-2-4-8(7)6-10(9)12;1-5-4-8(11)6(2)3-7(5)10-12-9/h1-6,11-12H;3-4,10-11H,1-2H3 |
| InChIKey | PQWNAZJQGRLXFX-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.32 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol?
The IUPAC name of (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol (CID 145310102) is (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol.
What is the SMILES notation for (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol?
The canonical SMILES for (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol is Cc1cc(NSI)c(C)cc1O.Oc1cc2ccccc2cc1O.
What is the InChIKey of (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol?
The InChIKey is PQWNAZJQGRLXFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O2.C8H10INOS/c11-9-5-7-3-1-2-4-8(7)6-10(9)12;1-5-4-8(11)6(2)3-7(5)10-12-9/h1-6,11-12H;3-4,10-11H,1-2H3.
What are the key properties of (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol?
(4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol has a molecular weight of 455.32 g/mol, XLogP of 5.67, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-hydroxy-2,5-dimethylanilino) thiohypoiodite;naphthalene-2,3-diol is sourced from PubChem (CID 145310102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).