C19H10N2S2 — CID 12915013
2-(1,2-diphenyl-4,6-dithiaspiro[2.3]hex-1-en-5-ylidene)propanedinitrile (PubChem CID 12915013) has the molecular formula C19H10N2S2 and a molecular weight of 330.44 g/mol. Its IUPAC name is 2-(1,2-diphenyl-4,6-dithiaspiro[2.3]hex-1-en-5-ylidene)propanedinitrile.
| Compound Name | 2-(1,2-diphenyl-4,6-dithiaspiro[2.3]hex-1-en-5-ylidene)propanedinitrile |
|---|---|
| PubChem CID | 12915013 |
| Molecular Formula | C19H10N2S2 |
| Molecular Weight | 330.44 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-(1,2-diphenyl-4,6-dithiaspiro[2.3]hex-1-en-5-ylidene)propanedinitrile |
| SMILES | N#CC(C#N)=C1SC2(S1)C(c1ccccc1)=C2c1ccccc1 |
| InChI | InChI=1S/C19H10N2S2/c20-11-15(12-21)18-22-19(23-18)16(13-7-3-1-4-8-13)17(19)14-9-5-2-6-10-14/h1-10H |
| InChIKey | XIHJSZLLZBSWQQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_D(3)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|