C13H12Br2 — CID 12915336
1,3-bis(bromomethyl)-2-methylnaphthalene (PubChem CID 12915336) has the molecular formula C13H12Br2 and a molecular weight of 328.05 g/mol. Its IUPAC name is 1,3-bis(bromomethyl)-2-methylnaphthalene.
| Compound Name | 1,3-bis(bromomethyl)-2-methylnaphthalene |
|---|---|
| PubChem CID | 12915336 |
| Molecular Formula | C13H12Br2 |
| Molecular Weight | 328.05 g/mol |
| Exact Mass | 325.93 |
| IUPAC Name | 1,3-bis(bromomethyl)-2-methylnaphthalene |
| SMILES | Cc1c(CBr)cc2ccccc2c1CBr |
| InChI | InChI=1S/C13H12Br2/c1-9-11(7-14)6-10-4-2-3-5-12(10)13(9)8-15/h2-6H,7-8H2,1H3 |
| InChIKey | YJMFXNYDMYOJLH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.05 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|