C11H12IN3OS — CID 129162983
4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine (PubChem CID 129162983) has the molecular formula C11H12IN3OS and a molecular weight of 361.21 g/mol. Its IUPAC name is 4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine.
| Compound Name | 4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine |
|---|---|
| PubChem CID | 129162983 |
| Molecular Formula | C11H12IN3OS |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 360.97 |
| IUPAC Name | 4-(3-iodo-1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine |
| SMILES | Sn1cc(I)c2cc(N3CCOCC3)cnc21 |
| InChI | InChI=1S/C11H12IN3OS/c12-10-7-15(17)11-9(10)5-8(6-13-11)14-1-3-16-4-2-14/h5-7,17H,1-4H2 |
| InChIKey | OMKXXNOAUKFGRF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 30.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|