C11H13N3OS — CID 170020349
4-(1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine (PubChem CID 170020349) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 4-(1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine.
| Compound Name | 4-(1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine |
|---|---|
| PubChem CID | 170020349 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 4-(1-sulfanylpyrrolo[2,3-b]pyridin-5-yl)morpholine |
| SMILES | Sn1ccc2cc(N3CCOCC3)cnc21 |
| InChI | InChI=1S/C11H13N3OS/c16-14-2-1-9-7-10(8-12-11(9)14)13-3-5-15-6-4-13/h1-2,7-8,16H,3-6H2 |
| InChIKey | NTUMXGRHWQOIED-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 30.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|