C18H21F2N3O2 — CID 129168841
(7R)-3-cyclobutyl-7-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione (PubChem CID 129168841) has the molecular formula C18H21F2N3O2 and a molecular weight of 349.38 g/mol. Its IUPAC name is (7R)-3-cyclobutyl-7-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione.
| Compound Name | (7R)-3-cyclobutyl-7-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 129168841 |
| Molecular Formula | C18H21F2N3O2 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (7R)-3-cyclobutyl-7-[(3E,5E)-4,5-difluorohepta-1,3,5-trien-2-yl]-5,6,7,8-tetrahydro-1H-pyrido[2,3-d]pyrimidine-2,4-dione |
| SMILES | C=C(/C=C(F)\C(F)=C/C)[C@H]1CCc2c([nH]c(=O)n(C3CCC3)c2=O)N1 |
| InChI | InChI=1S/C18H21F2N3O2/c1-3-13(19)14(20)9-10(2)15-8-7-12-16(21-15)22-18(25)23(17(12)24)11-5-4-6-11/h3,9,11,15,21H,2,4-8H2,1H3,(H,22,25)/b13-3+,14-9+/t15-/m1/s1 |
| InChIKey | YIDUIFILINCAPS-XYGKNVBKSA-N |
| XLogP | 3.27 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|