C19H22ClFN4O4S — CID 129177733
4-[[5-chloro-6-(2-methylpropoxy)-3-pyridinyl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 129177733) has the molecular formula C19H22ClFN4O4S and a molecular weight of 456.93 g/mol. Its IUPAC name is 4-[[5-chloro-6-(2-methylpropoxy)-3-pyridinyl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-[[5-chloro-6-(2-methylpropoxy)-3-pyridinyl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 129177733 |
| Molecular Formula | C19H22ClFN4O4S |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.10 |
| IUPAC Name | 4-[[5-chloro-6-(2-methylpropoxy)-3-pyridinyl]amino]-5-ethanimidoyl-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | [H]/N=C(\C)c1cc(C(=O)NS(C)(=O)=O)c(F)cc1Nc1cnc(OCC(C)C)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClFN4O4S/c1-10(2)9-29-19-15(20)5-12(8-23-19)24-17-7-16(21)14(6-13(17)11(3)22)18(26)25-30(4,27)28/h5-8,10,22,24H,9H2,1-4H3,(H,25,26)/b22-11+ |
| InChIKey | LVBFCAUXYKDJCB-SSDVNMTOSA-N |
| XLogP | 3.73 |
| TPSA | 121.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|