C42H62O5 — CID 129179665
8-[4-[2-[3-(4-butoxyphenyl)-3-hydroxybutan-2-yl]oxypropan-2-yl]phenoxy]-1-(4-butylphenyl)-3-methyloctan-1-ol (PubChem CID 129179665) has the molecular formula C42H62O5 and a molecular weight of 646.95 g/mol. Its IUPAC name is 8-[4-[2-[3-(4-butoxyphenyl)-3-hydroxybutan-2-yl]oxypropan-2-yl]phenoxy]-1-(4-butylphenyl)-3-methyloctan-1-ol.
| Compound Name | 8-[4-[2-[3-(4-butoxyphenyl)-3-hydroxybutan-2-yl]oxypropan-2-yl]phenoxy]-1-(4-butylphenyl)-3-methyloctan-1-ol |
|---|---|
| PubChem CID | 129179665 |
| Molecular Formula | C42H62O5 |
| Molecular Weight | 646.95 g/mol |
| Exact Mass | 646.46 |
| IUPAC Name | 8-[4-[2-[3-(4-butoxyphenyl)-3-hydroxybutan-2-yl]oxypropan-2-yl]phenoxy]-1-(4-butylphenyl)-3-methyloctan-1-ol |
| SMILES | CCCCOc1ccc(C(C)(O)C(C)OC(C)(C)c2ccc(OCCCCCC(C)CC(O)c3ccc(CCCC)cc3)cc2)cc1 |
| InChI | InChI=1S/C42H62O5/c1-8-10-16-34-17-19-35(20-18-34)40(43)31-32(3)15-13-12-14-30-46-38-25-21-36(22-26-38)41(5,6)47-33(4)42(7,44)37-23-27-39(28-24-37)45-29-11-9-2/h17-28,32-33,40,43-44H,8-16,29-31H2,1-7H3 |
| InChIKey | FIQMILIRDMDDCD-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.95 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|