C77H60N4O8 — CID 129183024
2-phenylmethoxy-6-[[5',6,6'-tris(2-cyano-3-phenylmethoxyphenoxy)-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]oxy]benzonitrile (PubChem CID 129183024) has the molecular formula C77H60N4O8 and a molecular weight of 1169.35 g/mol. Its IUPAC name is 2-phenylmethoxy-6-[[5',6,6'-tris(2-cyano-3-phenylmethoxyphenoxy)-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]oxy]benzonitrile.
| Compound Name | 2-phenylmethoxy-6-[[5',6,6'-tris(2-cyano-3-phenylmethoxyphenoxy)-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]oxy]benzonitrile |
|---|---|
| PubChem CID | 129183024 |
| Molecular Formula | C77H60N4O8 |
| Molecular Weight | 1169.35 g/mol |
| Exact Mass | 1168.44 |
| IUPAC Name | 2-phenylmethoxy-6-[[5',6,6'-tris(2-cyano-3-phenylmethoxyphenoxy)-1',1',3,3-tetramethyl-1,3'-spirobi[2H-indene]-5-yl]oxy]benzonitrile |
| SMILES | CC1(C)CC2(CC(C)(C)c3cc(Oc4cccc(OCc5ccccc5)c4C#N)c(Oc4cccc(OCc5ccccc5)c4C#N)cc32)c2cc(Oc3cccc(OCc4ccccc4)c3C#N)c(Oc3cccc(OCc4ccccc4)c3C#N)cc21 |
| InChI | InChI=1S/C77H60N4O8/c1-75(2)49-77(61-39-73(88-69-35-19-31-65(57(69)43-80)84-47-53-25-13-7-14-26-53)71(37-59(61)75)86-67-33-17-29-63(55(67)41-78)82-45-51-21-9-5-10-22-51)50-76(3,4)60-38-72(87-68-34-18-30-64(56(68)42-79)83-46-52-23-11-6-12-24-52)74(40-62(60)77)89-70-36-20-32-66(58(70)44-81)85-48-54-27-15-8-16-28-54/h5-40H,45-50H2,1-4H3 |
| InChIKey | NXOHEJXWMVBIRY-UHFFFAOYSA-N |
| XLogP | 18.31 |
| TPSA | 169.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 89 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1169.35 |
| LogP ≤ 5 | 18.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |