C23H19NO4 — CID 139786036
2-[5-(2-cyano-3-phenylmethoxyphenoxy)-2-methylphenyl]acetic acid (PubChem CID 139786036) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[5-(2-cyano-3-phenylmethoxyphenoxy)-2-methylphenyl]acetic acid.
| Compound Name | 2-[5-(2-cyano-3-phenylmethoxyphenoxy)-2-methylphenyl]acetic acid |
|---|---|
| PubChem CID | 139786036 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[5-(2-cyano-3-phenylmethoxyphenoxy)-2-methylphenyl]acetic acid |
| SMILES | Cc1ccc(Oc2cccc(OCc3ccccc3)c2C#N)cc1CC(=O)O |
| InChI | InChI=1S/C23H19NO4/c1-16-10-11-19(12-18(16)13-23(25)26)28-22-9-5-8-21(20(22)14-24)27-15-17-6-3-2-4-7-17/h2-12H,13,15H2,1H3,(H,25,26) |
| InChIKey | UTZHUCFKPYGNMU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |