C28H32ClN3O3 — CID 129186948
(E)-1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-[1-(3-chloropropyl)-2-methylindol-3-yl]prop-2-en-1-one (PubChem CID 129186948) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is (E)-1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-[1-(3-chloropropyl)-2-methylindol-3-yl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-[1-(3-chloropropyl)-2-methylindol-3-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 129186948 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (E)-1-[4-[2-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]-3-[1-(3-chloropropyl)-2-methylindol-3-yl]prop-2-en-1-one |
| SMILES | Cc1c(/C=C/C(=O)N2CCN(CCc3ccc4c(c3)OCO4)CC2)c2ccccc2n1CCCCl |
| InChI | InChI=1S/C28H32ClN3O3/c1-21-23(24-5-2-3-6-25(24)32(21)13-4-12-29)8-10-28(33)31-17-15-30(16-18-31)14-11-22-7-9-26-27(19-22)35-20-34-26/h2-3,5-10,19H,4,11-18,20H2,1H3/b10-8+ |
| InChIKey | RTBYBKGQUQYROP-CSKARUKUSA-N |
| XLogP | 4.71 |
| TPSA | 46.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|