C17H27N5O2 — CID 129192843
4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[(1-hydroxy-3-iminobutyl)amino]benzamide (PubChem CID 129192843) has the molecular formula C17H27N5O2 and a molecular weight of 333.44 g/mol. Its IUPAC name is 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[(1-hydroxy-3-iminobutyl)amino]benzamide.
| Compound Name | 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[(1-hydroxy-3-iminobutyl)amino]benzamide |
|---|---|
| PubChem CID | 129192843 |
| Molecular Formula | C17H27N5O2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.22 |
| IUPAC Name | 4-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[(1-hydroxy-3-iminobutyl)amino]benzamide |
| SMILES | [H]/N=C(\C)CC(O)Nc1cc(N[C@@H]2CCCC[C@@H]2N)ccc1C(N)=O |
| InChI | InChI=1S/C17H27N5O2/c1-10(18)8-16(23)22-15-9-11(6-7-12(15)17(20)24)21-14-5-3-2-4-13(14)19/h6-7,9,13-14,16,18,21-23H,2-5,8,19H2,1H3,(H2,20,24)/b18-10+/t13-,14+,16?/m0/s1 |
| InChIKey | BBSHAUAZBBLUFW-SOHUDEKESA-N |
| XLogP | 1.63 |
| TPSA | 137.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|