C20H27N7O — CID 129192712
6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[2-methanimidoyl-3-(methylamino)anilino]pyridine-3-carboxamide (PubChem CID 129192712) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[2-methanimidoyl-3-(methylamino)anilino]pyridine-3-carboxamide.
| Compound Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[2-methanimidoyl-3-(methylamino)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 129192712 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 6-[[(1R,2S)-2-aminocyclohexyl]amino]-2-[2-methanimidoyl-3-(methylamino)anilino]pyridine-3-carboxamide |
| SMILES | [H]/N=C/c1c(NC)cccc1Nc1nc(N[C@@H]2CCCC[C@@H]2N)ccc1C(N)=O |
| InChI | InChI=1S/C20H27N7O/c1-24-15-7-4-8-16(13(15)11-21)26-20-12(19(23)28)9-10-18(27-20)25-17-6-3-2-5-14(17)22/h4,7-11,14,17,21,24H,2-3,5-6,22H2,1H3,(H2,23,28)(H2,25,26,27)/b21-11+/t14-,17+/m0/s1 |
| InChIKey | UCVKLRSRKJOZIR-WLLOATOISA-N |
| XLogP | 2.65 |
| TPSA | 141.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|