C20H29NO7 — CID 129195249
6-O-tert-butyl 1-O-methyl (3S)-4-ethyl-3-[(4-hydroxy-3-nitrophenyl)methyl]hexanedioate (PubChem CID 129195249) has the molecular formula C20H29NO7 and a molecular weight of 395.45 g/mol. Its IUPAC name is 6-O-tert-butyl 1-O-methyl (3S)-4-ethyl-3-[(4-hydroxy-3-nitrophenyl)methyl]hexanedioate.
| Compound Name | 6-O-tert-butyl 1-O-methyl (3S)-4-ethyl-3-[(4-hydroxy-3-nitrophenyl)methyl]hexanedioate |
|---|---|
| PubChem CID | 129195249 |
| Molecular Formula | C20H29NO7 |
| Molecular Weight | 395.45 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 6-O-tert-butyl 1-O-methyl (3S)-4-ethyl-3-[(4-hydroxy-3-nitrophenyl)methyl]hexanedioate |
| SMILES | CCC(CC(=O)OC(C)(C)C)[C@H](CC(=O)OC)Cc1ccc(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H29NO7/c1-6-14(11-19(24)28-20(2,3)4)15(12-18(23)27-5)9-13-7-8-17(22)16(10-13)21(25)26/h7-8,10,14-15,22H,6,9,11-12H2,1-5H3/t14?,15-/m0/s1 |
| InChIKey | VGYDDYJUFDHRBP-LOACHALJSA-N |
| XLogP | 3.78 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|