C21H34N4O6 — CID 148830175
tert-butyl N-[(2R)-5-[2-(dimethylamino)ethylamino]-1-(4-hydroxy-3-nitrophenyl)-4-methyl-5-oxopentan-2-yl]carbamate (PubChem CID 148830175) has the molecular formula C21H34N4O6 and a molecular weight of 438.53 g/mol. Its IUPAC name is tert-butyl N-[(2R)-5-[2-(dimethylamino)ethylamino]-1-(4-hydroxy-3-nitrophenyl)-4-methyl-5-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-5-[2-(dimethylamino)ethylamino]-1-(4-hydroxy-3-nitrophenyl)-4-methyl-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 148830175 |
| Molecular Formula | C21H34N4O6 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | tert-butyl N-[(2R)-5-[2-(dimethylamino)ethylamino]-1-(4-hydroxy-3-nitrophenyl)-4-methyl-5-oxopentan-2-yl]carbamate |
| SMILES | CC(C[C@H](Cc1ccc(O)c([N+](=O)[O-])c1)NC(=O)OC(C)(C)C)C(=O)NCCN(C)C |
| InChI | InChI=1S/C21H34N4O6/c1-14(19(27)22-9-10-24(5)6)11-16(23-20(28)31-21(2,3)4)12-15-7-8-18(26)17(13-15)25(29)30/h7-8,13-14,16,26H,9-12H2,1-6H3,(H,22,27)(H,23,28)/t14?,16-/m1/s1 |
| InChIKey | OTNFVQMFNISKAN-BZSJEYESSA-N |
| XLogP | 2.44 |
| TPSA | 134.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|