C31H43N5O5 — CID 129200097
N-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide (PubChem CID 129200097) has the molecular formula C31H43N5O5 and a molecular weight of 565.72 g/mol. Its IUPAC name is N-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide.
| Compound Name | N-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
|---|---|
| PubChem CID | 129200097 |
| Molecular Formula | C31H43N5O5 |
| Molecular Weight | 565.72 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | N-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethyl]-3-(2,5-dioxopyrrol-1-yl)propanamide |
| SMILES | CCCCCc1cc2c(CCCCCNC(=O)CCOCCNC(=O)CCN3C(=O)C=CC3=O)cccc2nc1N |
| InChI | InChI=1S/C31H43N5O5/c1-2-3-5-10-24-22-25-23(11-8-12-26(25)35-31(24)32)9-6-4-7-17-33-28(38)16-20-41-21-18-34-27(37)15-19-36-29(39)13-14-30(36)40/h8,11-14,22H,2-7,9-10,15-21H2,1H3,(H2,32,35)(H,33,38)(H,34,37) |
| InChIKey | ABXGWECTDXVGAR-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.72 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|