C37H56N4O10 — CID 129226246
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (PubChem CID 129226246) has the molecular formula C37H56N4O10 and a molecular weight of 716.87 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
|---|---|
| PubChem CID | 129226246 |
| Molecular Formula | C37H56N4O10 |
| Molecular Weight | 716.87 g/mol |
| Exact Mass | 716.40 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-[5-(2-amino-3-pentylquinolin-5-yl)pentylamino]-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| SMILES | CCCCCc1cc2c(CCCCCNC(=O)CCOCCOCCOCCOCCOCCC(=O)ON3C(=O)CCC3=O)cccc2nc1N |
| InChI | InChI=1S/C37H56N4O10/c1-2-3-5-10-30-28-31-29(11-8-12-32(31)40-37(30)38)9-6-4-7-17-39-33(42)15-18-46-20-22-48-24-26-50-27-25-49-23-21-47-19-16-36(45)51-41-34(43)13-14-35(41)44/h8,11-12,28H,2-7,9-10,13-27H2,1H3,(H2,38,40)(H,39,42) |
| InChIKey | SCJJYSKOFURNFL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 177.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.87 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|