C18H18F2N4O5S — CID 129211779
2-(benzenesulfonyl)-2-[6-(3,3-difluorocyclobutyl)oxy-2-methyl-5-nitropyrimidin-4-yl]-N-methylethanimine (PubChem CID 129211779) has the molecular formula C18H18F2N4O5S and a molecular weight of 440.43 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-2-[6-(3,3-difluorocyclobutyl)oxy-2-methyl-5-nitropyrimidin-4-yl]-N-methylethanimine.
| Compound Name | 2-(benzenesulfonyl)-2-[6-(3,3-difluorocyclobutyl)oxy-2-methyl-5-nitropyrimidin-4-yl]-N-methylethanimine |
|---|---|
| PubChem CID | 129211779 |
| Molecular Formula | C18H18F2N4O5S |
| Molecular Weight | 440.43 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | 2-(benzenesulfonyl)-2-[6-(3,3-difluorocyclobutyl)oxy-2-methyl-5-nitropyrimidin-4-yl]-N-methylethanimine |
| SMILES | C/N=C/C(c1nc(C)nc(OC2CC(F)(F)C2)c1[N+](=O)[O-])S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C18H18F2N4O5S/c1-11-22-15(14(10-21-2)30(27,28)13-6-4-3-5-7-13)16(24(25)26)17(23-11)29-12-8-18(19,20)9-12/h3-7,10,12,14H,8-9H2,1-2H3/b21-10+ |
| InChIKey | DWILYFSLXNUOFD-UFFVCSGVSA-N |
| XLogP | 3.09 |
| TPSA | 124.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|