C27H38N4O5 — CID 129215769
2-[[(1R)-6-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]-methylamino]-1-hydroxyhexyl]amino]-3-phenylpropanamide (PubChem CID 129215769) has the molecular formula C27H38N4O5 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2-[[(1R)-6-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]-methylamino]-1-hydroxyhexyl]amino]-3-phenylpropanamide.
| Compound Name | 2-[[(1R)-6-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]-methylamino]-1-hydroxyhexyl]amino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 129215769 |
| Molecular Formula | C27H38N4O5 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | 2-[[(1R)-6-[[2-acetamido-3-(4-hydroxyphenyl)propanoyl]-methylamino]-1-hydroxyhexyl]amino]-3-phenylpropanamide |
| SMILES | CC(=O)NC(Cc1ccc(O)cc1)C(=O)N(C)CCCCC[C@@H](O)NC(Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C27H38N4O5/c1-19(32)29-24(18-21-12-14-22(33)15-13-21)27(36)31(2)16-8-4-7-11-25(34)30-23(26(28)35)17-20-9-5-3-6-10-20/h3,5-6,9-10,12-15,23-25,30,33-34H,4,7-8,11,16-18H2,1-2H3,(H2,28,35)(H,29,32)/t23?,24?,25-/m1/s1 |
| InChIKey | PDICBODDQVTSFP-DDJHWDJXSA-N |
| XLogP | 1.46 |
| TPSA | 144.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|