C25H36N6O6 — CID 129215788
2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[1-hydroxy-3-(4-hydroxyphenyl)-1-methoxypropan-2-yl]pentanamide (PubChem CID 129215788) has the molecular formula C25H36N6O6 and a molecular weight of 516.60 g/mol. Its IUPAC name is 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[1-hydroxy-3-(4-hydroxyphenyl)-1-methoxypropan-2-yl]pentanamide.
| Compound Name | 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[1-hydroxy-3-(4-hydroxyphenyl)-1-methoxypropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 129215788 |
| Molecular Formula | C25H36N6O6 |
| Molecular Weight | 516.60 g/mol |
| Exact Mass | 516.27 |
| IUPAC Name | 2-[[2-amino-3-(4-hydroxyphenyl)propanoyl]amino]-5-(diaminomethylideneamino)-N-[1-hydroxy-3-(4-hydroxyphenyl)-1-methoxypropan-2-yl]pentanamide |
| SMILES | COC(O)C(Cc1ccc(O)cc1)NC(=O)C(CCCN=C(N)N)NC(=O)C(N)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H36N6O6/c1-37-24(36)21(14-16-6-10-18(33)11-7-16)31-23(35)20(3-2-12-29-25(27)28)30-22(34)19(26)13-15-4-8-17(32)9-5-15/h4-11,19-21,24,32-33,36H,2-3,12-14,26H2,1H3,(H,30,34)(H,31,35)(H4,27,28,29) |
| InChIKey | YBRRAYQYUOLYLJ-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 218.54 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.60 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|