C41H58N6O7 — CID 129218629
6-[[1-[[1-[4-[5-(2-amino-3-pentylquinolin-5-yl)pentylcarbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoic acid (PubChem CID 129218629) has the molecular formula C41H58N6O7 and a molecular weight of 746.95 g/mol. Its IUPAC name is 6-[[1-[[1-[4-[5-(2-amino-3-pentylquinolin-5-yl)pentylcarbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoic acid.
| Compound Name | 6-[[1-[[1-[4-[5-(2-amino-3-pentylquinolin-5-yl)pentylcarbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoic acid |
|---|---|
| PubChem CID | 129218629 |
| Molecular Formula | C41H58N6O7 |
| Molecular Weight | 746.95 g/mol |
| Exact Mass | 746.44 |
| IUPAC Name | 6-[[1-[[1-[4-[5-(2-amino-3-pentylquinolin-5-yl)pentylcarbamoyloxymethyl]anilino]-1-oxopropan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]amino]-6-oxohexanoic acid |
| SMILES | CCCCCc1cc2c(CCCCCNC(=O)OCc3ccc(NC(=O)C(C)NC(=O)C(NC(=O)CCCCC(=O)O)C(C)C)cc3)cccc2nc1N |
| InChI | InChI=1S/C41H58N6O7/c1-5-6-8-15-31-25-33-30(16-13-17-34(33)46-38(31)42)14-9-7-12-24-43-41(53)54-26-29-20-22-32(23-21-29)45-39(51)28(4)44-40(52)37(27(2)3)47-35(48)18-10-11-19-36(49)50/h13,16-17,20-23,25,27-28,37H,5-12,14-15,18-19,24,26H2,1-4H3,(H2,42,46)(H,43,53)(H,44,52)(H,45,51)(H,47,48)(H,49,50) |
| InChIKey | XCVYZKWLLRTNGZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 201.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.95 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|