C42H62N6O7 — CID 135278023
[4-[2-[[(2S)-2-(7,7-dihydroxyheptanoylamino)-3-methylbutanoyl]amino]propanoylamino]phenyl]methyl N-[5-(2-amino-3-pentylquinolin-5-yl)pentyl]carbamate (PubChem CID 135278023) has the molecular formula C42H62N6O7 and a molecular weight of 762.99 g/mol. Its IUPAC name is [4-[2-[[(2S)-2-(7,7-dihydroxyheptanoylamino)-3-methylbutanoyl]amino]propanoylamino]phenyl]methyl N-[5-(2-amino-3-pentylquinolin-5-yl)pentyl]carbamate.
| Compound Name | [4-[2-[[(2S)-2-(7,7-dihydroxyheptanoylamino)-3-methylbutanoyl]amino]propanoylamino]phenyl]methyl N-[5-(2-amino-3-pentylquinolin-5-yl)pentyl]carbamate |
|---|---|
| PubChem CID | 135278023 |
| Molecular Formula | C42H62N6O7 |
| Molecular Weight | 762.99 g/mol |
| Exact Mass | 762.47 |
| IUPAC Name | [4-[2-[[(2S)-2-(7,7-dihydroxyheptanoylamino)-3-methylbutanoyl]amino]propanoylamino]phenyl]methyl N-[5-(2-amino-3-pentylquinolin-5-yl)pentyl]carbamate |
| SMILES | CCCCCc1cc2c(CCCCCNC(=O)OCc3ccc(NC(=O)C(C)NC(=O)[C@@H](NC(=O)CCCCCC(O)O)C(C)C)cc3)cccc2nc1N |
| InChI | InChI=1S/C42H62N6O7/c1-5-6-9-16-32-26-34-31(17-14-18-35(34)47-39(32)43)15-10-8-13-25-44-42(54)55-27-30-21-23-33(24-22-30)46-40(52)29(4)45-41(53)38(28(2)3)48-36(49)19-11-7-12-20-37(50)51/h14,17-18,21-24,26,28-29,37-38,50-51H,5-13,15-16,19-20,25,27H2,1-4H3,(H2,43,47)(H,44,54)(H,45,53)(H,46,52)(H,48,49)/t29?,38-/m0/s1 |
| InChIKey | AOSKVENZXCJPNX-JRSKRTLYSA-N |
| XLogP | 6.03 |
| TPSA | 205.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.99 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|