C22H15F2N3OS — CID 129223328
7-[5-(2,3-difluorophenyl)-2-methylphenyl]-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one (PubChem CID 129223328) has the molecular formula C22H15F2N3OS and a molecular weight of 407.45 g/mol. Its IUPAC name is 7-[5-(2,3-difluorophenyl)-2-methylphenyl]-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one.
| Compound Name | 7-[5-(2,3-difluorophenyl)-2-methylphenyl]-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
|---|---|
| PubChem CID | 129223328 |
| Molecular Formula | C22H15F2N3OS |
| Molecular Weight | 407.45 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | 7-[5-(2,3-difluorophenyl)-2-methylphenyl]-3-methyl-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraen-6-one |
| SMILES | Cc1ccc(-c2cccc(F)c2F)cc1N1C(=O)Nc2c(C)sc3nccc1c23 |
| InChI | InChI=1S/C22H15F2N3OS/c1-11-6-7-13(14-4-3-5-15(23)19(14)24)10-17(11)27-16-8-9-25-21-18(16)20(12(2)29-21)26-22(27)28/h3-10H,1-2H3,(H,26,28) |
| InChIKey | ASEFZGJSKZNDPA-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.45 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |