C9H14N2O — CID 129230724
(E,1S,5S,8S)-N-methoxy-6-methyl-6-azatricyclo[3.2.1.03,8]octan-4-imine (PubChem CID 129230724) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (E,1S,5S,8S)-N-methoxy-6-methyl-6-azatricyclo[3.2.1.03,8]octan-4-imine.
| Compound Name | (E,1S,5S,8S)-N-methoxy-6-methyl-6-azatricyclo[3.2.1.03,8]octan-4-imine |
|---|---|
| PubChem CID | 129230724 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (E,1S,5S,8S)-N-methoxy-6-methyl-6-azatricyclo[3.2.1.03,8]octan-4-imine |
| SMILES | CO/N=C1\C2C[C@@H]3CN(C)[C@H]1[C@H]23 |
| InChI | InChI=1S/C9H14N2O/c1-11-4-5-3-6-7(5)9(11)8(6)10-12-2/h5-7,9H,3-4H2,1-2H3/b10-8+/t5-,6?,7+,9+/m1/s1 |
| InChIKey | HPZXVZCTVFOMDG-PGYTZIINSA-N |
| XLogP | 0.57 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|