C18H25N4O6P — CID 129235228
[5-[3-(formylcarbamoyl)-6,7-dimethyl-2-methyliminoquinoxalin-1-yl]-3-hydroxypentyl]peroxyphosphinous acid (PubChem CID 129235228) has the molecular formula C18H25N4O6P and a molecular weight of 424.39 g/mol. Its IUPAC name is [5-[3-(formylcarbamoyl)-6,7-dimethyl-2-methyliminoquinoxalin-1-yl]-3-hydroxypentyl]peroxyphosphinous acid.
| Compound Name | [5-[3-(formylcarbamoyl)-6,7-dimethyl-2-methyliminoquinoxalin-1-yl]-3-hydroxypentyl]peroxyphosphinous acid |
|---|---|
| PubChem CID | 129235228 |
| Molecular Formula | C18H25N4O6P |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | [5-[3-(formylcarbamoyl)-6,7-dimethyl-2-methyliminoquinoxalin-1-yl]-3-hydroxypentyl]peroxyphosphinous acid |
| SMILES | C/N=c1\c(C(=O)NC=O)nc2cc(C)c(C)cc2n1CCC(O)CCOOPO |
| InChI | InChI=1S/C18H25N4O6P/c1-11-8-14-15(9-12(11)2)22(6-4-13(24)5-7-27-28-29-26)17(19-3)16(21-14)18(25)20-10-23/h8-10,13,24,26,29H,4-7H2,1-3H3,(H,20,23,25)/b19-17+ |
| InChIKey | PADLGGGCLIRNMX-HTXNQAPBSA-N |
| XLogP | 0.66 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|