About 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine
5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine (PubChem CID 129238000) has the molecular formula C4H5N3O
and a molecular weight of 111.10 g/mol. Its IUPAC name is 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine.
Analyze 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine?
The IUPAC name of 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine (CID 129238000) is 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine.
What is the SMILES notation for 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine?
The canonical SMILES for 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine is NC1=NN=C2CC2O1.
What is the InChIKey of 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine?
The InChIKey is BSTIVPBNJOPMJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O/c5-4-7-6-2-1-3(2)8-4/h3H,1H2,(H2,5,7).
What are the key properties of 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine?
5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine has a molecular weight of 111.10 g/mol, XLogP of -0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxa-2,3-diazabicyclo[4.1.0]hepta-1,3-dien-4-amine is sourced from PubChem (CID 129238000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).