C25H30F2N2O2 — CID 129239226
2-(3,3-dimethylbutyl)-4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]isoquinolin-1-one (PubChem CID 129239226) has the molecular formula C25H30F2N2O2 and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-(3,3-dimethylbutyl)-4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]isoquinolin-1-one.
| Compound Name | 2-(3,3-dimethylbutyl)-4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]isoquinolin-1-one |
|---|---|
| PubChem CID | 129239226 |
| Molecular Formula | C25H30F2N2O2 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | 2-(3,3-dimethylbutyl)-4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]isoquinolin-1-one |
| SMILES | COCCNCc1ccc(-c2ccc3c(=O)n(CCC(C)(C)C)cc(F)c3c2)c(F)c1 |
| InChI | InChI=1S/C25H30F2N2O2/c1-25(2,3)9-11-29-16-23(27)21-14-18(6-8-20(21)24(29)30)19-7-5-17(13-22(19)26)15-28-10-12-31-4/h5-8,13-14,16,28H,9-12,15H2,1-4H3 |
| InChIKey | YZBGMZHNTZDVQO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|