C26H29F2N3O4 — CID 129239306
(2S)-2-[2-[4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]ethyl]-N-hydroxy-2-methylbut-3-enamide (PubChem CID 129239306) has the molecular formula C26H29F2N3O4 and a molecular weight of 485.53 g/mol. Its IUPAC name is (2S)-2-[2-[4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]ethyl]-N-hydroxy-2-methylbut-3-enamide.
| Compound Name | (2S)-2-[2-[4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]ethyl]-N-hydroxy-2-methylbut-3-enamide |
|---|---|
| PubChem CID | 129239306 |
| Molecular Formula | C26H29F2N3O4 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | (2S)-2-[2-[4-fluoro-6-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]-1-oxoisoquinolin-2-yl]ethyl]-N-hydroxy-2-methylbut-3-enamide |
| SMILES | C=C[C@](C)(CCn1cc(F)c2cc(-c3ccc(CNCCOC)cc3F)ccc2c1=O)C(=O)NO |
| InChI | InChI=1S/C26H29F2N3O4/c1-4-26(2,25(33)30-34)9-11-31-16-23(28)21-14-18(6-8-20(21)24(31)32)19-7-5-17(13-22(19)27)15-29-10-12-35-3/h4-8,13-14,16,29,34H,1,9-12,15H2,2-3H3,(H,30,33)/t26-/m1/s1 |
| InChIKey | VSCHRGXXHLQMAE-AREMUKBSSA-N |
| XLogP | 3.77 |
| TPSA | 92.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|