C22H24FN3O5S — CID 129239536
4-[6-(6-ethoxy-3-pyridinyl)-4-fluoro-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfinylbutanamide (PubChem CID 129239536) has the molecular formula C22H24FN3O5S and a molecular weight of 461.52 g/mol. Its IUPAC name is 4-[6-(6-ethoxy-3-pyridinyl)-4-fluoro-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfinylbutanamide.
| Compound Name | 4-[6-(6-ethoxy-3-pyridinyl)-4-fluoro-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfinylbutanamide |
|---|---|
| PubChem CID | 129239536 |
| Molecular Formula | C22H24FN3O5S |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 4-[6-(6-ethoxy-3-pyridinyl)-4-fluoro-1-oxoisoquinolin-2-yl]-N-hydroxy-2-methyl-2-methylsulfinylbutanamide |
| SMILES | CCOc1ccc(-c2ccc3c(=O)n(CCC(C)(C(=O)NO)S(C)=O)cc(F)c3c2)cn1 |
| InChI | InChI=1S/C22H24FN3O5S/c1-4-31-19-8-6-15(12-24-19)14-5-7-16-17(11-14)18(23)13-26(20(16)27)10-9-22(2,32(3)30)21(28)25-29/h5-8,11-13,29H,4,9-10H2,1-3H3,(H,25,28) |
| InChIKey | RMMXCDPFCYESKL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|