C27H44N2O6S — CID 167458990
ethane;N-(1-methoxybutoxy)-4-[4-(4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfinylbutanamide (PubChem CID 167458990) has the molecular formula C27H44N2O6S and a molecular weight of 524.72 g/mol. Its IUPAC name is ethane;N-(1-methoxybutoxy)-4-[4-(4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfinylbutanamide.
| Compound Name | ethane;N-(1-methoxybutoxy)-4-[4-(4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfinylbutanamide |
|---|---|
| PubChem CID | 167458990 |
| Molecular Formula | C27H44N2O6S |
| Molecular Weight | 524.72 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | ethane;N-(1-methoxybutoxy)-4-[4-(4-methoxyphenyl)-2-oxo-1-pyridinyl]-2-methyl-2-methylsulfinylbutanamide |
| SMILES | CC.CC.CCCC(OC)ONC(=O)C(C)(CCn1ccc(-c2ccc(OC)cc2)cc1=O)S(C)=O |
| InChI | InChI=1S/C23H32N2O6S.2C2H6/c1-6-7-21(30-4)31-24-22(27)23(2,32(5)28)13-15-25-14-12-18(16-20(25)26)17-8-10-19(29-3)11-9-17;2*1-2/h8-12,14,16,21H,6-7,13,15H2,1-5H3,(H,24,27);2*1-2H3 |
| InChIKey | UUFCFFPVXKEVOG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.72 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|