About (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine
(3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine (PubChem CID 129241267) has the molecular formula C13H14F3N5
and a molecular weight of 297.28 g/mol. Its IUPAC name is (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine.
Molecular Properties
| Compound Name | (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine |
| PubChem CID | 129241267 |
| Molecular Formula | C13H14F3N5 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine |
| SMILES | N[C@H]1C[C@@H](C(F)(F)F)CN(c2ccnc3nccnc23)C1 |
| InChI | InChI=1S/C13H14F3N5/c14-13(15,16)8-5-9(17)7-21(6-8)10-1-2-19-12-11(10)18-3-4-20-12/h1-4,8-9H,5-7,17H2/t8-,9+/m1/s1 |
| InChIKey | JCIUVLIKRVQXRA-BDAKNGLRSA-N |
| XLogP | 1.74 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine?
The IUPAC name of (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine (CID 129241267) is (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine.
What is the SMILES notation for (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine?
The canonical SMILES for (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine is N[C@H]1C[C@@H](C(F)(F)F)CN(c2ccnc3nccnc23)C1.
What is the InChIKey of (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine?
The InChIKey is JCIUVLIKRVQXRA-BDAKNGLRSA-N. The full InChI is InChI=1S/C13H14F3N5/c14-13(15,16)8-5-9(17)7-21(6-8)10-1-2-19-12-11(10)18-3-4-20-12/h1-4,8-9H,5-7,17H2/t8-,9+/m1/s1.
What are the key properties of (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine?
(3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine has a molecular weight of 297.28 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5R)-1-pyrido[2,3-b]pyrazin-8-yl-5-(trifluoromethyl)piperidin-3-amine is sourced from PubChem (CID 129241267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).