C12H12F3N5 — CID 175987024
4-[4-(trifluoromethyl)piperidin-1-yl]pteridine (PubChem CID 175987024) has the molecular formula C12H12F3N5 and a molecular weight of 283.26 g/mol. Its IUPAC name is 4-[4-(trifluoromethyl)piperidin-1-yl]pteridine.
| Compound Name | 4-[4-(trifluoromethyl)piperidin-1-yl]pteridine |
|---|---|
| PubChem CID | 175987024 |
| Molecular Formula | C12H12F3N5 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 4-[4-(trifluoromethyl)piperidin-1-yl]pteridine |
| SMILES | FC(F)(F)C1CCN(c2ncnc3nccnc23)CC1 |
| InChI | InChI=1S/C12H12F3N5/c13-12(14,15)8-1-5-20(6-2-8)11-9-10(18-7-19-11)17-4-3-16-9/h3-4,7-8H,1-2,5-6H2 |
| InChIKey | YDCJJOCMDJLVLH-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 54.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |