C25H20N+ — CID 129243431
1-(1,2,2-triphenylethenyl)pyridin-1-ium (PubChem CID 129243431) has the molecular formula C25H20N+ and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-(1,2,2-triphenylethenyl)pyridin-1-ium.
| Compound Name | 1-(1,2,2-triphenylethenyl)pyridin-1-ium |
|---|---|
| PubChem CID | 129243431 |
| Molecular Formula | C25H20N+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-(1,2,2-triphenylethenyl)pyridin-1-ium |
| SMILES | c1ccc(C(=C(c2ccccc2)[n+]2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H20N/c1-5-13-21(14-6-1)24(22-15-7-2-8-16-22)25(23-17-9-3-10-18-23)26-19-11-4-12-20-26/h1-20H/q+1 |
| InChIKey | OXWVMOYMGHZMHE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|