C11H23NO6S — CID 129251874
N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propyl-2-sulfanylacetamide (PubChem CID 129251874) has the molecular formula C11H23NO6S and a molecular weight of 297.37 g/mol. Its IUPAC name is N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propyl-2-sulfanylacetamide.
| Compound Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propyl-2-sulfanylacetamide |
|---|---|
| PubChem CID | 129251874 |
| Molecular Formula | C11H23NO6S |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-N-propyl-2-sulfanylacetamide |
| SMILES | CCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=O)CS |
| InChI | InChI=1S/C11H23NO6S/c1-2-3-12(9(16)6-19)4-7(14)10(17)11(18)8(15)5-13/h7-8,10-11,13-15,17-19H,2-6H2,1H3/t7-,8+,10+,11+/m0/s1 |
| InChIKey | SWCDKHMKWIHYHY-SCVMZPAESA-N |
| XLogP | -2.41 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|