C10H21NO5S2 — CID 102527023
[(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propylcarbamodithioic acid (PubChem CID 102527023) has the molecular formula C10H21NO5S2 and a molecular weight of 299.41 g/mol. Its IUPAC name is [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propylcarbamodithioic acid.
| Compound Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propylcarbamodithioic acid |
|---|---|
| PubChem CID | 102527023 |
| Molecular Formula | C10H21NO5S2 |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | [(2S,3R,4R,5R)-2,3,4,5,6-pentahydroxyhexyl]-propylcarbamodithioic acid |
| SMILES | CCCN(C[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO)C(=S)S |
| InChI | InChI=1S/C10H21NO5S2/c1-2-3-11(10(17)18)4-6(13)8(15)9(16)7(14)5-12/h6-9,12-16H,2-5H2,1H3,(H,17,18)/t6-,7+,8+,9+/m0/s1 |
| InChIKey | HHOXBIIPESXWCE-JQCXWYLXSA-N |
| XLogP | -1.65 |
| TPSA | 104.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | -1.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|