C17H25ClN4O2 — CID 129258078
1-(6-chloro-5-methyl-2-pyridinyl)-3-[1-[(2S)-2-methylbutanoyl]piperidin-4-yl]urea (PubChem CID 129258078) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is 1-(6-chloro-5-methyl-2-pyridinyl)-3-[1-[(2S)-2-methylbutanoyl]piperidin-4-yl]urea.
| Compound Name | 1-(6-chloro-5-methyl-2-pyridinyl)-3-[1-[(2S)-2-methylbutanoyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 129258078 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-(6-chloro-5-methyl-2-pyridinyl)-3-[1-[(2S)-2-methylbutanoyl]piperidin-4-yl]urea |
| SMILES | CC[C@H](C)C(=O)N1CCC(NC(=O)Nc2ccc(C)c(Cl)n2)CC1 |
| InChI | InChI=1S/C17H25ClN4O2/c1-4-11(2)16(23)22-9-7-13(8-10-22)19-17(24)21-14-6-5-12(3)15(18)20-14/h5-6,11,13H,4,7-10H2,1-3H3,(H2,19,20,21,24)/t11-/m0/s1 |
| InChIKey | SWWORGHMEASJIE-NSHDSACASA-N |
| XLogP | 3.20 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|