C11H12N2O2S2 — CID 129258409
(3E,5Z)-N-(1,3-thiazol-2-yl)octa-1,3,5,7-tetraene-4-sulfonamide (PubChem CID 129258409) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3E,5Z)-N-(1,3-thiazol-2-yl)octa-1,3,5,7-tetraene-4-sulfonamide.
| Compound Name | (3E,5Z)-N-(1,3-thiazol-2-yl)octa-1,3,5,7-tetraene-4-sulfonamide |
|---|---|
| PubChem CID | 129258409 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | (3E,5Z)-N-(1,3-thiazol-2-yl)octa-1,3,5,7-tetraene-4-sulfonamide |
| SMILES | C=C/C=C\C(=C/C=C)S(=O)(=O)Nc1nccs1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-3-5-7-10(6-4-2)17(14,15)13-11-12-8-9-16-11/h3-9H,1-2H2,(H,12,13)/b7-5-,10-6+ |
| InChIKey | HXOUSYWSYXKCMK-ZPRNNRRZSA-N |
| XLogP | 2.70 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|