C8H9FN2S — CID 135175993
N-[(2E)-3-fluoropenta-2,4-dienyl]-1,3-thiazol-2-amine (PubChem CID 135175993) has the molecular formula C8H9FN2S and a molecular weight of 184.24 g/mol. Its IUPAC name is N-[(2E)-3-fluoropenta-2,4-dienyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(2E)-3-fluoropenta-2,4-dienyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 135175993 |
| Molecular Formula | C8H9FN2S |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | N-[(2E)-3-fluoropenta-2,4-dienyl]-1,3-thiazol-2-amine |
| SMILES | C=C/C(F)=C\CNc1nccs1 |
| InChI | InChI=1S/C8H9FN2S/c1-2-7(9)3-4-10-8-11-5-6-12-8/h2-3,5-6H,1,4H2,(H,10,11)/b7-3+ |
| InChIKey | YCMRXMWMOOUUAX-XVNBXDOJSA-N |
| XLogP | 2.59 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|